C14H25NO7S — CID 88634274
1-O-tert-butyl 3-O-methyl 5-methyl-4-methylsulfonyloxypiperidine-1,3-dicarboxylate (PubChem CID 88634274) has the molecular formula C14H25NO7S and a molecular weight of 351.42 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-methyl 5-methyl-4-methylsulfonyloxypiperidine-1,3-dicarboxylate.
| Compound Name | 1-O-tert-butyl 3-O-methyl 5-methyl-4-methylsulfonyloxypiperidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 88634274 |
| Molecular Formula | C14H25NO7S |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 1-O-tert-butyl 3-O-methyl 5-methyl-4-methylsulfonyloxypiperidine-1,3-dicarboxylate |
| SMILES | COC(=O)C1CN(C(=O)OC(C)(C)C)CC(C)C1OS(C)(=O)=O |
| InChI | InChI=1S/C14H25NO7S/c1-9-7-15(13(17)21-14(2,3)4)8-10(12(16)20-5)11(9)22-23(6,18)19/h9-11H,7-8H2,1-6H3 |
| InChIKey | JJLUVGUAKIJZKV-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|