C18H19Cl2NO2 — CID 88634417
3,6-dichloro-4-(6-phenylhexyl)pyridine-2-carboxylic acid (PubChem CID 88634417) has the molecular formula C18H19Cl2NO2 and a molecular weight of 352.26 g/mol. Its IUPAC name is 3,6-dichloro-4-(6-phenylhexyl)pyridine-2-carboxylic acid.
| Compound Name | 3,6-dichloro-4-(6-phenylhexyl)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 88634417 |
| Molecular Formula | C18H19Cl2NO2 |
| Molecular Weight | 352.26 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 3,6-dichloro-4-(6-phenylhexyl)pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1nc(Cl)cc(CCCCCCc2ccccc2)c1Cl |
| InChI | InChI=1S/C18H19Cl2NO2/c19-15-12-14(16(20)17(21-15)18(22)23)11-7-2-1-4-8-13-9-5-3-6-10-13/h3,5-6,9-10,12H,1-2,4,7-8,11H2,(H,22,23) |
| InChIKey | ABGYGOZDKJSVIB-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.26 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|