C32H40F5NOS — CID 88635336
4-[6-hydroxy-1-[10-(4,4,5,5,5-pentafluoropentylsulfanyl)decyl]-1,2,3,4-tetrahydronaphthalen-2-yl]benzonitrile (PubChem CID 88635336) has the molecular formula C32H40F5NOS and a molecular weight of 581.74 g/mol. Its IUPAC name is 4-[6-hydroxy-1-[10-(4,4,5,5,5-pentafluoropentylsulfanyl)decyl]-1,2,3,4-tetrahydronaphthalen-2-yl]benzonitrile.
| Compound Name | 4-[6-hydroxy-1-[10-(4,4,5,5,5-pentafluoropentylsulfanyl)decyl]-1,2,3,4-tetrahydronaphthalen-2-yl]benzonitrile |
|---|---|
| PubChem CID | 88635336 |
| Molecular Formula | C32H40F5NOS |
| Molecular Weight | 581.74 g/mol |
| Exact Mass | 581.28 |
| IUPAC Name | 4-[6-hydroxy-1-[10-(4,4,5,5,5-pentafluoropentylsulfanyl)decyl]-1,2,3,4-tetrahydronaphthalen-2-yl]benzonitrile |
| SMILES | N#Cc1ccc(C2CCc3cc(O)ccc3C2CCCCCCCCCCSCCCC(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C32H40F5NOS/c33-31(34,32(35,36)37)19-9-21-40-20-8-6-4-2-1-3-5-7-10-30-28(25-13-11-24(23-38)12-14-25)17-15-26-22-27(39)16-18-29(26)30/h11-14,16,18,22,28,30,39H,1-10,15,17,19-21H2 |
| InChIKey | YJJYDIONHNABES-UHFFFAOYSA-N |
| XLogP | 10.30 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.74 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|