C28H32F2O5 — CID 88636501
(6S,8S,9R,10S,11S,13S,14S,16S,17R)-6,9-difluoro-11,17-dihydroxy-10,13,16-trimethyl-17-(2-phenoxyoxiran-2-yl)-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one (PubChem CID 88636501) has the molecular formula C28H32F2O5 and a molecular weight of 486.56 g/mol. Its IUPAC name is (6S,8S,9R,10S,11S,13S,14S,16S,17R)-6,9-difluoro-11,17-dihydroxy-10,13,16-trimethyl-17-(2-phenoxyoxiran-2-yl)-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (6S,8S,9R,10S,11S,13S,14S,16S,17R)-6,9-difluoro-11,17-dihydroxy-10,13,16-trimethyl-17-(2-phenoxyoxiran-2-yl)-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 88636501 |
| Molecular Formula | C28H32F2O5 |
| Molecular Weight | 486.56 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | (6S,8S,9R,10S,11S,13S,14S,16S,17R)-6,9-difluoro-11,17-dihydroxy-10,13,16-trimethyl-17-(2-phenoxyoxiran-2-yl)-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@H]1C[C@H]2[C@@H]3C[C@H](F)C4=CC(=O)C=C[C@]4(C)[C@@]3(F)[C@@H](O)C[C@]2(C)C1(O)C1(Oc2ccccc2)CO1 |
| InChI | InChI=1S/C28H32F2O5/c1-16-11-19-20-13-22(29)21-12-17(31)9-10-24(21,2)27(20,30)23(32)14-25(19,3)28(16,33)26(15-34-26)35-18-7-5-4-6-8-18/h4-10,12,16,19-20,22-23,32-33H,11,13-15H2,1-3H3/t16-,19-,20-,22-,23-,24-,25-,26?,27-,28?/m0/s1 |
| InChIKey | GCFWXYXNHRINCL-YGDAOGMASA-N |
| XLogP | 4.09 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.56 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|