About dichlorophosphoryl acetate;2-hydroxyethyl(trimethyl)azanium
dichlorophosphoryl acetate;2-hydroxyethyl(trimethyl)azanium (PubChem CID 88636873) has the molecular formula C7H17Cl2NO4P+
and a molecular weight of 281.10 g/mol. Its IUPAC name is dichlorophosphoryl acetate;2-hydroxyethyl(trimethyl)azanium.
Molecular Properties
| Compound Name | dichlorophosphoryl acetate;2-hydroxyethyl(trimethyl)azanium |
| PubChem CID | 88636873 |
| Molecular Formula | C7H17Cl2NO4P+ |
| Molecular Weight | 281.10 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | dichlorophosphoryl acetate;2-hydroxyethyl(trimethyl)azanium |
| SMILES | CC(=O)OP(=O)(Cl)Cl.C[N+](C)(C)CCO |
| InChI | InChI=1S/C5H14NO.C2H3Cl2O3P/c1-6(2,3)4-5-7;1-2(5)7-8(3,4)6/h7H,4-5H2,1-3H3;1H3/q+1; |
| InChIKey | XCMIZXGCQFKKRR-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.10 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze dichlorophosphoryl acetate;2-hydroxyethyl(trimethyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorophosphoryl acetate;2-hydroxyethyl(trimethyl)azanium?
The IUPAC name of dichlorophosphoryl acetate;2-hydroxyethyl(trimethyl)azanium (CID 88636873) is dichlorophosphoryl acetate;2-hydroxyethyl(trimethyl)azanium.
What is the SMILES notation for dichlorophosphoryl acetate;2-hydroxyethyl(trimethyl)azanium?
The canonical SMILES for dichlorophosphoryl acetate;2-hydroxyethyl(trimethyl)azanium is CC(=O)OP(=O)(Cl)Cl.C[N+](C)(C)CCO.
What is the InChIKey of dichlorophosphoryl acetate;2-hydroxyethyl(trimethyl)azanium?
The InChIKey is XCMIZXGCQFKKRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H14NO.C2H3Cl2O3P/c1-6(2,3)4-5-7;1-2(5)7-8(3,4)6/h7H,4-5H2,1-3H3;1H3/q+1;.
What are the key properties of dichlorophosphoryl acetate;2-hydroxyethyl(trimethyl)azanium?
dichlorophosphoryl acetate;2-hydroxyethyl(trimethyl)azanium has a molecular weight of 281.10 g/mol, XLogP of 1.82, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorophosphoryl acetate;2-hydroxyethyl(trimethyl)azanium is sourced from PubChem (CID 88636873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).