C16H16N4OS2 — CID 8863706
3-[(2,4-dimethylphenoxy)methyl]-4-[(Z)-thiophen-2-ylmethylideneamino]-1H-1,2,4-triazole-5-thione (PubChem CID 8863706) has the molecular formula C16H16N4OS2 and a molecular weight of 344.47 g/mol. Its IUPAC name is 3-[(2,4-dimethylphenoxy)methyl]-4-[(Z)-thiophen-2-ylmethylideneamino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[(2,4-dimethylphenoxy)methyl]-4-[(Z)-thiophen-2-ylmethylideneamino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 8863706 |
| Molecular Formula | C16H16N4OS2 |
| Molecular Weight | 344.47 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 3-[(2,4-dimethylphenoxy)methyl]-4-[(Z)-thiophen-2-ylmethylideneamino]-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1ccc(OCc2n[nH]c(=S)n2/N=C\c2cccs2)c(C)c1 |
| InChI | InChI=1S/C16H16N4OS2/c1-11-5-6-14(12(2)8-11)21-10-15-18-19-16(22)20(15)17-9-13-4-3-7-23-13/h3-9H,10H2,1-2H3,(H,19,22)/b17-9- |
| InChIKey | MPHIFTLCSUPRSE-MFOYZWKCSA-N |
| XLogP | 4.08 |
| TPSA | 55.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.47 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|