About (4-acetamidophenyl) prop-2-ynoate;guanidine
(4-acetamidophenyl) prop-2-ynoate;guanidine (PubChem CID 88638302) has the molecular formula C12H14N4O3
and a molecular weight of 262.27 g/mol. Its IUPAC name is (4-acetamidophenyl) prop-2-ynoate;guanidine.
Molecular Properties
| Compound Name | (4-acetamidophenyl) prop-2-ynoate;guanidine |
| PubChem CID | 88638302 |
| Molecular Formula | C12H14N4O3 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | (4-acetamidophenyl) prop-2-ynoate;guanidine |
| SMILES | C#CC(=O)Oc1ccc(NC(C)=O)cc1.[H]N=C(N)N |
| InChI | InChI=1S/C11H9NO3.CH5N3/c1-3-11(14)15-10-6-4-9(5-7-10)12-8(2)13;2-1(3)4/h1,4-7H,2H3,(H,12,13);(H5,2,3,4) |
| InChIKey | XOHHFDYEMUTLDV-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 131.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-acetamidophenyl) prop-2-ynoate;guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-acetamidophenyl) prop-2-ynoate;guanidine?
The IUPAC name of (4-acetamidophenyl) prop-2-ynoate;guanidine (CID 88638302) is (4-acetamidophenyl) prop-2-ynoate;guanidine.
What is the SMILES notation for (4-acetamidophenyl) prop-2-ynoate;guanidine?
The canonical SMILES for (4-acetamidophenyl) prop-2-ynoate;guanidine is C#CC(=O)Oc1ccc(NC(C)=O)cc1.[H]N=C(N)N.
What is the InChIKey of (4-acetamidophenyl) prop-2-ynoate;guanidine?
The InChIKey is XOHHFDYEMUTLDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO3.CH5N3/c1-3-11(14)15-10-6-4-9(5-7-10)12-8(2)13;2-1(3)4/h1,4-7H,2H3,(H,12,13);(H5,2,3,4).
What are the key properties of (4-acetamidophenyl) prop-2-ynoate;guanidine?
(4-acetamidophenyl) prop-2-ynoate;guanidine has a molecular weight of 262.27 g/mol, XLogP of 0.02, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-acetamidophenyl) prop-2-ynoate;guanidine is sourced from PubChem (CID 88638302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).