C31H34N2O11 — CID 88638774
2-[[6-[[(1S,3S)-3-acetyl-3,5,12-trihydroxy-10-methoxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]-3-hydroxy-2-methyloxan-4-yl]-(2-hydroxyethyl)amino]acetonitrile (PubChem CID 88638774) has the molecular formula C31H34N2O11 and a molecular weight of 610.62 g/mol. Its IUPAC name is 2-[[6-[[(1S,3S)-3-acetyl-3,5,12-trihydroxy-10-methoxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]-3-hydroxy-2-methyloxan-4-yl]-(2-hydroxyethyl)amino]acetonitrile.
| Compound Name | 2-[[6-[[(1S,3S)-3-acetyl-3,5,12-trihydroxy-10-methoxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]-3-hydroxy-2-methyloxan-4-yl]-(2-hydroxyethyl)amino]acetonitrile |
|---|---|
| PubChem CID | 88638774 |
| Molecular Formula | C31H34N2O11 |
| Molecular Weight | 610.62 g/mol |
| Exact Mass | 610.22 |
| IUPAC Name | 2-[[6-[[(1S,3S)-3-acetyl-3,5,12-trihydroxy-10-methoxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl]oxy]-3-hydroxy-2-methyloxan-4-yl]-(2-hydroxyethyl)amino]acetonitrile |
| SMILES | COc1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)C[C@@](O)(C(C)=O)C[C@@H]3OC1CC(N(CC#N)CCO)C(O)C(C)O1 |
| InChI | InChI=1S/C31H34N2O11/c1-14-26(36)18(33(8-7-32)9-10-34)11-21(43-14)44-20-13-31(41,15(2)35)12-17-23(20)30(40)25-24(28(17)38)27(37)16-5-4-6-19(42-3)22(16)29(25)39/h4-6,14,18,20-21,26,34,36,38,40-41H,8-13H2,1-3H3/t14?,18?,20-,21?,26?,31-/m0/s1 |
| InChIKey | HDRONMZHDGNWBJ-VGZMTVPCSA-N |
| XLogP | 0.89 |
| TPSA | 207.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.62 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|