C21H24N2O5S — CID 88640018
[4-[(Z)-2-benzamido-3-oxo-3-(propan-2-ylamino)prop-1-enyl]phenyl] ethanesulfonate (PubChem CID 88640018) has the molecular formula C21H24N2O5S and a molecular weight of 416.50 g/mol. Its IUPAC name is [4-[(Z)-2-benzamido-3-oxo-3-(propan-2-ylamino)prop-1-enyl]phenyl] ethanesulfonate.
| Compound Name | [4-[(Z)-2-benzamido-3-oxo-3-(propan-2-ylamino)prop-1-enyl]phenyl] ethanesulfonate |
|---|---|
| PubChem CID | 88640018 |
| Molecular Formula | C21H24N2O5S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | [4-[(Z)-2-benzamido-3-oxo-3-(propan-2-ylamino)prop-1-enyl]phenyl] ethanesulfonate |
| SMILES | CCS(=O)(=O)Oc1ccc(/C=C(\NC(=O)c2ccccc2)C(=O)NC(C)C)cc1 |
| InChI | InChI=1S/C21H24N2O5S/c1-4-29(26,27)28-18-12-10-16(11-13-18)14-19(21(25)22-15(2)3)23-20(24)17-8-6-5-7-9-17/h5-15H,4H2,1-3H3,(H,22,25)(H,23,24)/b19-14- |
| InChIKey | ZGNZXLGZANJOMC-RGEXLXHISA-N |
| XLogP | 2.71 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|