C20H29FN3O3S+ — CID 8864057
3-[(6R)-6-(3-fluorophenyl)-5-(2-methoxyethoxycarbonyl)-4-methyl-2-sulfanylidene-1,6-dihydropyrimidin-3-yl]propyl-dimethylazanium (PubChem CID 8864057) has the molecular formula C20H29FN3O3S+ and a molecular weight of 410.54 g/mol. Its IUPAC name is 3-[(6R)-6-(3-fluorophenyl)-5-(2-methoxyethoxycarbonyl)-4-methyl-2-sulfanylidene-1,6-dihydropyrimidin-3-yl]propyl-dimethylazanium.
| Compound Name | 3-[(6R)-6-(3-fluorophenyl)-5-(2-methoxyethoxycarbonyl)-4-methyl-2-sulfanylidene-1,6-dihydropyrimidin-3-yl]propyl-dimethylazanium |
|---|---|
| PubChem CID | 8864057 |
| Molecular Formula | C20H29FN3O3S+ |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | 3-[(6R)-6-(3-fluorophenyl)-5-(2-methoxyethoxycarbonyl)-4-methyl-2-sulfanylidene-1,6-dihydropyrimidin-3-yl]propyl-dimethylazanium |
| SMILES | COCCOC(=O)C1=C(C)N(CCC[NH+](C)C)C(=S)N[C@@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C20H28FN3O3S/c1-14-17(19(25)27-12-11-26-4)18(15-7-5-8-16(21)13-15)22-20(28)24(14)10-6-9-23(2)3/h5,7-8,13,18H,6,9-12H2,1-4H3,(H,22,28)/p+1/t18-/m1/s1 |
| InChIKey | QETJKTMRMMEBAQ-GOSISDBHSA-O |
| XLogP | 1.06 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|