C21H30N3O3S+ — CID 8863994
3-[(6S)-5-methoxycarbonyl-4-methyl-6-(3-prop-2-enoxyphenyl)-2-sulfanylidene-1,6-dihydropyrimidin-3-yl]propyl-dimethylazanium (PubChem CID 8863994) has the molecular formula C21H30N3O3S+ and a molecular weight of 404.56 g/mol. Its IUPAC name is 3-[(6S)-5-methoxycarbonyl-4-methyl-6-(3-prop-2-enoxyphenyl)-2-sulfanylidene-1,6-dihydropyrimidin-3-yl]propyl-dimethylazanium.
| Compound Name | 3-[(6S)-5-methoxycarbonyl-4-methyl-6-(3-prop-2-enoxyphenyl)-2-sulfanylidene-1,6-dihydropyrimidin-3-yl]propyl-dimethylazanium |
|---|---|
| PubChem CID | 8863994 |
| Molecular Formula | C21H30N3O3S+ |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 3-[(6S)-5-methoxycarbonyl-4-methyl-6-(3-prop-2-enoxyphenyl)-2-sulfanylidene-1,6-dihydropyrimidin-3-yl]propyl-dimethylazanium |
| SMILES | C=CCOc1cccc([C@@H]2NC(=S)N(CCC[NH+](C)C)C(C)=C2C(=O)OC)c1 |
| InChI | InChI=1S/C21H29N3O3S/c1-6-13-27-17-10-7-9-16(14-17)19-18(20(25)26-5)15(2)24(21(28)22-19)12-8-11-23(3)4/h6-7,9-10,14,19H,1,8,11-13H2,2-5H3,(H,22,28)/p+1/t19-/m0/s1 |
| InChIKey | DZFUPRVOPHZUKR-IBGZPJMESA-O |
| XLogP | 1.46 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|