C22H20N2OS — CID 8864137
(2R)-1-(1H-indol-3-yl)-2-[[(R)-phenyl(thiophen-2-yl)methyl]amino]propan-1-one (PubChem CID 8864137) has the molecular formula C22H20N2OS and a molecular weight of 360.48 g/mol. Its IUPAC name is (2R)-1-(1H-indol-3-yl)-2-[[(R)-phenyl(thiophen-2-yl)methyl]amino]propan-1-one.
| Compound Name | (2R)-1-(1H-indol-3-yl)-2-[[(R)-phenyl(thiophen-2-yl)methyl]amino]propan-1-one |
|---|---|
| PubChem CID | 8864137 |
| Molecular Formula | C22H20N2OS |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | (2R)-1-(1H-indol-3-yl)-2-[[(R)-phenyl(thiophen-2-yl)methyl]amino]propan-1-one |
| SMILES | C[C@@H](N[C@H](c1ccccc1)c1cccs1)C(=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C22H20N2OS/c1-15(22(25)18-14-23-19-11-6-5-10-17(18)19)24-21(20-12-7-13-26-20)16-8-3-2-4-9-16/h2-15,21,23-24H,1H3/t15-,21-/m1/s1 |
| InChIKey | MXIFFBWLJAKXJA-QVKFZJNVSA-N |
| XLogP | 5.18 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |