C11H14N4O4S3 — CID 88641537
(6R)-7-formamido-8-oxo-3-(5H-1,2,4-thiadiazol-4-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid (PubChem CID 88641537) has the molecular formula C11H14N4O4S3 and a molecular weight of 362.46 g/mol. Its IUPAC name is (6R)-7-formamido-8-oxo-3-(5H-1,2,4-thiadiazol-4-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid.
| Compound Name | (6R)-7-formamido-8-oxo-3-(5H-1,2,4-thiadiazol-4-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
|---|---|
| PubChem CID | 88641537 |
| Molecular Formula | C11H14N4O4S3 |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | (6R)-7-formamido-8-oxo-3-(5H-1,2,4-thiadiazol-4-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
| SMILES | O=CNC1C(=O)N2CC(CSN3C=NSC3)(C(=O)O)CS[C@H]12 |
| InChI | InChI=1S/C11H14N4O4S3/c16-5-12-7-8(17)15-1-11(10(18)19,2-20-9(7)15)3-22-14-4-13-21-6-14/h4-5,7,9H,1-3,6H2,(H,12,16)(H,18,19)/t7?,9-,11?/m1/s1 |
| InChIKey | MJUDGQLRCDIKJI-PUDKOPFASA-N |
| XLogP | -0.32 |
| TPSA | 102.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|