C9H13IN2O4SSi — CID 173424234
silyl (6R)-7-formamido-3-(iodomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate (PubChem CID 173424234) has the molecular formula C9H13IN2O4SSi and a molecular weight of 400.27 g/mol. Its IUPAC name is silyl (6R)-7-formamido-3-(iodomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate.
| Compound Name | silyl (6R)-7-formamido-3-(iodomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
|---|---|
| PubChem CID | 173424234 |
| Molecular Formula | C9H13IN2O4SSi |
| Molecular Weight | 400.27 g/mol |
| Exact Mass | 399.94 |
| IUPAC Name | silyl (6R)-7-formamido-3-(iodomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
| SMILES | O=CNC1C(=O)N2CC(CI)(C(=O)O[SiH3])CS[C@H]12 |
| InChI | InChI=1S/C9H13IN2O4SSi/c10-1-9(8(15)16-18)2-12-6(14)5(11-4-13)7(12)17-3-9/h4-5,7H,1-3H2,18H3,(H,11,13)/t5?,7-,9?/m1/s1 |
| InChIKey | SEWIKLQRPZMVTP-HUASBAKNSA-N |
| XLogP | -1.74 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.27 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|