C37H40N4O7P2 — CID 88644963
3-diethoxyphosphoryl-5-phenylmethoxy-9H-pyrido[3,4-b]indole;3-diethoxyphosphoryl-9H-pyrido[3,4-b]indole (PubChem CID 88644963) has the molecular formula C37H40N4O7P2 and a molecular weight of 714.70 g/mol. Its IUPAC name is 3-diethoxyphosphoryl-5-phenylmethoxy-9H-pyrido[3,4-b]indole;3-diethoxyphosphoryl-9H-pyrido[3,4-b]indole.
| Compound Name | 3-diethoxyphosphoryl-5-phenylmethoxy-9H-pyrido[3,4-b]indole;3-diethoxyphosphoryl-9H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 88644963 |
| Molecular Formula | C37H40N4O7P2 |
| Molecular Weight | 714.70 g/mol |
| Exact Mass | 714.24 |
| IUPAC Name | 3-diethoxyphosphoryl-5-phenylmethoxy-9H-pyrido[3,4-b]indole;3-diethoxyphosphoryl-9H-pyrido[3,4-b]indole |
| SMILES | CCOP(=O)(OCC)c1cc2c(cn1)[nH]c1cccc(OCc3ccccc3)c12.CCOP(=O)(OCC)c1cc2c(cn1)[nH]c1ccccc12 |
| InChI | InChI=1S/C22H23N2O4P.C15H17N2O3P/c1-3-27-29(25,28-4-2)21-13-17-19(14-23-21)24-18-11-8-12-20(22(17)18)26-15-16-9-6-5-7-10-16;1-3-19-21(18,20-4-2)15-9-12-11-7-5-6-8-13(11)17-14(12)10-16-15/h5-14,24H,3-4,15H2,1-2H3;5-10,17H,3-4H2,1-2H3 |
| InChIKey | CNJSBOOAXURBCT-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 137.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.70 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|