C21H25N3O4S2 — CID 88646922
(2S)-1-[(2S)-1-[(2S)-2-(benzylsulfanylamino)-4-sulfanylidenebut-3-enoyl]pyrrolidine-2-carbonyl]pyrrolidine-2-carboxylic acid (PubChem CID 88646922) has the molecular formula C21H25N3O4S2 and a molecular weight of 447.58 g/mol. Its IUPAC name is (2S)-1-[(2S)-1-[(2S)-2-(benzylsulfanylamino)-4-sulfanylidenebut-3-enoyl]pyrrolidine-2-carbonyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[(2S)-1-[(2S)-2-(benzylsulfanylamino)-4-sulfanylidenebut-3-enoyl]pyrrolidine-2-carbonyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 88646922 |
| Molecular Formula | C21H25N3O4S2 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | (2S)-1-[(2S)-1-[(2S)-2-(benzylsulfanylamino)-4-sulfanylidenebut-3-enoyl]pyrrolidine-2-carbonyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCN1C(=O)[C@@H]1CCCN1C(=O)[C@H](C=C=S)NSCc1ccccc1 |
| InChI | InChI=1S/C21H25N3O4S2/c25-19(16(10-13-29)22-30-14-15-6-2-1-3-7-15)23-11-4-8-17(23)20(26)24-12-5-9-18(24)21(27)28/h1-3,6-7,10,16-18,22H,4-5,8-9,11-12,14H2,(H,27,28)/t16-,17-,18-/m0/s1 |
| InChIKey | SCFVUXXQVVMZGL-BZSNNMDCSA-N |
| XLogP | 2.01 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|