C14H24ClNO4 — CID 88647511
bis(3-carboxypropyl)-bis(prop-2-enyl)azanium chloride (PubChem CID 88647511) has the molecular formula C14H24ClNO4 and a molecular weight of 305.80 g/mol. Its IUPAC name is bis(3-carboxypropyl)-bis(prop-2-enyl)azanium chloride.
| Compound Name | bis(3-carboxypropyl)-bis(prop-2-enyl)azanium chloride |
|---|---|
| PubChem CID | 88647511 |
| Molecular Formula | C14H24ClNO4 |
| Molecular Weight | 305.80 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | bis(3-carboxypropyl)-bis(prop-2-enyl)azanium chloride |
| SMILES | C=CC[N+](CC=C)(CCCC(=O)O)CCCC(=O)O.[Cl-] |
| InChI | InChI=1S/C14H23NO4.ClH/c1-3-9-15(10-4-2,11-5-7-13(16)17)12-6-8-14(18)19;/h3-4H,1-2,5-12H2,(H-,16,17,18,19);1H |
| InChIKey | QOPOJUBDNHFCBT-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.80 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|