C22H40NO6+ — CID 177496402
tris(3-carboxypropyl)-[(E)-dec-2-enyl]azanium (PubChem CID 177496402) has the molecular formula C22H40NO6+ and a molecular weight of 414.56 g/mol. Its IUPAC name is tris(3-carboxypropyl)-[(E)-dec-2-enyl]azanium.
| Compound Name | tris(3-carboxypropyl)-[(E)-dec-2-enyl]azanium |
|---|---|
| PubChem CID | 177496402 |
| Molecular Formula | C22H40NO6+ |
| Molecular Weight | 414.56 g/mol |
| Exact Mass | 414.29 |
| IUPAC Name | tris(3-carboxypropyl)-[(E)-dec-2-enyl]azanium |
| SMILES | CCCCCCC/C=C/C[N+](CCCC(=O)O)(CCCC(=O)O)CCCC(=O)O |
| InChI | InChI=1S/C22H39NO6/c1-2-3-4-5-6-7-8-9-16-23(17-10-13-20(24)25,18-11-14-21(26)27)19-12-15-22(28)29/h8-9H,2-7,10-19H2,1H3,(H2-,24,25,26,27,28,29)/p+1/b9-8+ |
| InChIKey | YGRWOVAWTBQMPZ-CMDGGOBGSA-O |
| XLogP | 4.31 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.56 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|