C27H26N2O9S2 — CID 88652145
(4-methoxyphenyl)methyl (6R,7R)-7-amino-3-[(3,4-diacetyloxybenzoyl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 88652145) has the molecular formula C27H26N2O9S2 and a molecular weight of 586.64 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl (6R,7R)-7-amino-3-[(3,4-diacetyloxybenzoyl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | (4-methoxyphenyl)methyl (6R,7R)-7-amino-3-[(3,4-diacetyloxybenzoyl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 88652145 |
| Molecular Formula | C27H26N2O9S2 |
| Molecular Weight | 586.64 g/mol |
| Exact Mass | 586.11 |
| IUPAC Name | (4-methoxyphenyl)methyl (6R,7R)-7-amino-3-[(3,4-diacetyloxybenzoyl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | COc1ccc(COC(=O)C2=C(CSC(=O)c3ccc(OC(C)=O)c(OC(C)=O)c3)CS[C@@H]3[C@H](N)C(=O)N23)cc1 |
| InChI | InChI=1S/C27H26N2O9S2/c1-14(30)37-20-9-6-17(10-21(20)38-15(2)31)27(34)40-13-18-12-39-25-22(28)24(32)29(25)23(18)26(33)36-11-16-4-7-19(35-3)8-5-16/h4-10,22,25H,11-13,28H2,1-3H3/t22-,25-/m1/s1 |
| InChIKey | NQTIGVGWBOTLML-RCZVLFRGSA-N |
| XLogP | 2.66 |
| TPSA | 151.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.64 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|