About azane;6-butyldecan-5-yl dihydrogen phosphate
azane;6-butyldecan-5-yl dihydrogen phosphate (PubChem CID 88652298) has the molecular formula C14H34NO4P
and a molecular weight of 311.40 g/mol. Its IUPAC name is azane;6-butyldecan-5-yl dihydrogen phosphate.
Molecular Properties
| Compound Name | azane;6-butyldecan-5-yl dihydrogen phosphate |
| PubChem CID | 88652298 |
| Molecular Formula | C14H34NO4P |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | azane;6-butyldecan-5-yl dihydrogen phosphate |
| SMILES | CCCCC(CCCC)C(CCCC)OP(=O)(O)O.N |
| InChI | InChI=1S/C14H31O4P.H3N/c1-4-7-10-13(11-8-5-2)14(12-9-6-3)18-19(15,16)17;/h13-14H,4-12H2,1-3H3,(H2,15,16,17);1H3 |
| InChIKey | ZKEKBOAQSUPXOG-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 101.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze azane;6-butyldecan-5-yl dihydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;6-butyldecan-5-yl dihydrogen phosphate?
The IUPAC name of azane;6-butyldecan-5-yl dihydrogen phosphate (CID 88652298) is azane;6-butyldecan-5-yl dihydrogen phosphate.
What is the SMILES notation for azane;6-butyldecan-5-yl dihydrogen phosphate?
The canonical SMILES for azane;6-butyldecan-5-yl dihydrogen phosphate is CCCCC(CCCC)C(CCCC)OP(=O)(O)O.N.
What is the InChIKey of azane;6-butyldecan-5-yl dihydrogen phosphate?
The InChIKey is ZKEKBOAQSUPXOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H31O4P.H3N/c1-4-7-10-13(11-8-5-2)14(12-9-6-3)18-19(15,16)17;/h13-14H,4-12H2,1-3H3,(H2,15,16,17);1H3.
What are the key properties of azane;6-butyldecan-5-yl dihydrogen phosphate?
azane;6-butyldecan-5-yl dihydrogen phosphate has a molecular weight of 311.40 g/mol, XLogP of 4.81, 12 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;6-butyldecan-5-yl dihydrogen phosphate is sourced from PubChem (CID 88652298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).