About 2-carboxyoxyethyl 2-methyl-3-pentylperoxyprop-2-enoate
2-carboxyoxyethyl 2-methyl-3-pentylperoxyprop-2-enoate (PubChem CID 88652306) has the molecular formula C12H20O7
and a molecular weight of 276.28 g/mol. Its IUPAC name is 2-carboxyoxyethyl 2-methyl-3-pentylperoxyprop-2-enoate.
Molecular Properties
| Compound Name | 2-carboxyoxyethyl 2-methyl-3-pentylperoxyprop-2-enoate |
| PubChem CID | 88652306 |
| Molecular Formula | C12H20O7 |
| Molecular Weight | 276.28 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 2-carboxyoxyethyl 2-methyl-3-pentylperoxyprop-2-enoate |
| SMILES | CCCCCOOC=C(C)C(=O)OCCOC(=O)O |
| InChI | InChI=1S/C12H20O7/c1-3-4-5-6-18-19-9-10(2)11(13)16-7-8-17-12(14)15/h9H,3-8H2,1-2H3,(H,14,15) |
| InChIKey | CGEZQEWABQNBTQ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.28 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-carboxyoxyethyl 2-methyl-3-pentylperoxyprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-carboxyoxyethyl 2-methyl-3-pentylperoxyprop-2-enoate?
The IUPAC name of 2-carboxyoxyethyl 2-methyl-3-pentylperoxyprop-2-enoate (CID 88652306) is 2-carboxyoxyethyl 2-methyl-3-pentylperoxyprop-2-enoate.
What is the SMILES notation for 2-carboxyoxyethyl 2-methyl-3-pentylperoxyprop-2-enoate?
The canonical SMILES for 2-carboxyoxyethyl 2-methyl-3-pentylperoxyprop-2-enoate is CCCCCOOC=C(C)C(=O)OCCOC(=O)O.
What is the InChIKey of 2-carboxyoxyethyl 2-methyl-3-pentylperoxyprop-2-enoate?
The InChIKey is CGEZQEWABQNBTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O7/c1-3-4-5-6-18-19-9-10(2)11(13)16-7-8-17-12(14)15/h9H,3-8H2,1-2H3,(H,14,15).
What are the key properties of 2-carboxyoxyethyl 2-methyl-3-pentylperoxyprop-2-enoate?
2-carboxyoxyethyl 2-methyl-3-pentylperoxyprop-2-enoate has a molecular weight of 276.28 g/mol, XLogP of 2.27, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-carboxyoxyethyl 2-methyl-3-pentylperoxyprop-2-enoate is sourced from PubChem (CID 88652306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).