About sodium;3-ethyloctane;4-oxo-4-sulfooxybutanoate
sodium;3-ethyloctane;4-oxo-4-sulfooxybutanoate (PubChem CID 88653422) has the molecular formula C14H27NaO7S
and a molecular weight of 362.42 g/mol. Its IUPAC name is sodium;3-ethyloctane;4-oxo-4-sulfooxybutanoate.
Molecular Properties
| Compound Name | sodium;3-ethyloctane;4-oxo-4-sulfooxybutanoate |
| PubChem CID | 88653422 |
| Molecular Formula | C14H27NaO7S |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | sodium;3-ethyloctane;4-oxo-4-sulfooxybutanoate |
| SMILES | CCCCCC(CC)CC.O=C([O-])CCC(=O)OS(=O)(=O)O.[Na+] |
| InChI | InChI=1S/C10H22.C4H6O7S.Na/c1-4-7-8-9-10(5-2)6-3;5-3(6)1-2-4(7)11-12(8,9)10;/h10H,4-9H2,1-3H3;1-2H2,(H,5,6)(H,8,9,10);/q;;+1/p-1 |
| InChIKey | AACRIPGSHHXAPW-UHFFFAOYSA-M |
| XLogP | -1.13 |
| TPSA | 120.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;3-ethyloctane;4-oxo-4-sulfooxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;3-ethyloctane;4-oxo-4-sulfooxybutanoate?
The IUPAC name of sodium;3-ethyloctane;4-oxo-4-sulfooxybutanoate (CID 88653422) is sodium;3-ethyloctane;4-oxo-4-sulfooxybutanoate.
What is the SMILES notation for sodium;3-ethyloctane;4-oxo-4-sulfooxybutanoate?
The canonical SMILES for sodium;3-ethyloctane;4-oxo-4-sulfooxybutanoate is CCCCCC(CC)CC.O=C([O-])CCC(=O)OS(=O)(=O)O.[Na+].
What is the InChIKey of sodium;3-ethyloctane;4-oxo-4-sulfooxybutanoate?
The InChIKey is AACRIPGSHHXAPW-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H22.C4H6O7S.Na/c1-4-7-8-9-10(5-2)6-3;5-3(6)1-2-4(7)11-12(8,9)10;/h10H,4-9H2,1-3H3;1-2H2,(H,5,6)(H,8,9,10);/q;;+1/p-1.
What are the key properties of sodium;3-ethyloctane;4-oxo-4-sulfooxybutanoate?
sodium;3-ethyloctane;4-oxo-4-sulfooxybutanoate has a molecular weight of 362.42 g/mol, XLogP of -1.13, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;3-ethyloctane;4-oxo-4-sulfooxybutanoate is sourced from PubChem (CID 88653422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).