C6H13O7PS — CID 88655409
CID 88655409 (PubChem CID 88655409) has the molecular formula C6H13O7PS and a molecular weight of 260.20 g/mol.
| Compound Name | CID 88655409 |
|---|---|
| PubChem CID | 88655409 |
| Molecular Formula | C6H13O7PS |
| Molecular Weight | 260.20 g/mol |
| Exact Mass | 260.01 |
| IUPAC Name | — |
| SMILES | C=CCOCC=C.O=P(O)(O)S(=O)(=O)O |
| InChI | InChI=1S/C6H10O.H3O6PS/c1-3-5-7-6-4-2;1-7(2,3)8(4,5)6/h3-4H,1-2,5-6H2;(H2,1,2,3)(H,4,5,6) |
| InChIKey | ZUHNWGJUNKDNQE-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.20 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|