About magnesium;3-prop-2-enoxyprop-1-ene;sulfate
magnesium;3-prop-2-enoxyprop-1-ene;sulfate (PubChem CID 87083397) has the molecular formula C6H10MgO5S
and a molecular weight of 218.51 g/mol. Its IUPAC name is magnesium;3-prop-2-enoxyprop-1-ene;sulfate.
Molecular Properties
| Compound Name | magnesium;3-prop-2-enoxyprop-1-ene;sulfate |
| PubChem CID | 87083397 |
| Molecular Formula | C6H10MgO5S |
| Molecular Weight | 218.51 g/mol |
| Exact Mass | 218.01 |
| IUPAC Name | magnesium;3-prop-2-enoxyprop-1-ene;sulfate |
| SMILES | C=CCOCC=C.O=S(=O)([O-])[O-].[Mg+2] |
| InChI | InChI=1S/C6H10O.Mg.H2O4S/c1-3-5-7-6-4-2;;1-5(2,3)4/h3-4H,1-2,5-6H2;;(H2,1,2,3,4)/q;+2;/p-2 |
| InChIKey | ZSELEQBHQMBRJF-UHFFFAOYSA-L |
| XLogP | -0.34 |
| TPSA | 89.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.51 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze magnesium;3-prop-2-enoxyprop-1-ene;sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;3-prop-2-enoxyprop-1-ene;sulfate?
The IUPAC name of magnesium;3-prop-2-enoxyprop-1-ene;sulfate (CID 87083397) is magnesium;3-prop-2-enoxyprop-1-ene;sulfate.
What is the SMILES notation for magnesium;3-prop-2-enoxyprop-1-ene;sulfate?
The canonical SMILES for magnesium;3-prop-2-enoxyprop-1-ene;sulfate is C=CCOCC=C.O=S(=O)([O-])[O-].[Mg+2].
What is the InChIKey of magnesium;3-prop-2-enoxyprop-1-ene;sulfate?
The InChIKey is ZSELEQBHQMBRJF-UHFFFAOYSA-L. The full InChI is InChI=1S/C6H10O.Mg.H2O4S/c1-3-5-7-6-4-2;;1-5(2,3)4/h3-4H,1-2,5-6H2;;(H2,1,2,3,4)/q;+2;/p-2.
What are the key properties of magnesium;3-prop-2-enoxyprop-1-ene;sulfate?
magnesium;3-prop-2-enoxyprop-1-ene;sulfate has a molecular weight of 218.51 g/mol, XLogP of -0.34, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;3-prop-2-enoxyprop-1-ene;sulfate is sourced from PubChem (CID 87083397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).