About 6h-Indolo[3,2-c]quinolin-6-one
6h-Indolo[3,2-c]quinolin-6-one (PubChem CID 88656895) has the molecular formula C15H8N2O
and a molecular weight of 232.24 g/mol. Its IUPAC name is indolo[3,2-c]quinolin-6-one.
Molecular Properties
| Compound Name | 6h-Indolo[3,2-c]quinolin-6-one |
| PubChem CID | 88656895 |
| Molecular Formula | C15H8N2O |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | indolo[3,2-c]quinolin-6-one |
| SMILES | C1=CC2=C3C(=C4C=CC=CC4=NC3=O)N=C2C=C1 |
| InChI | InChI=1S/C15H8N2O/c18-15-13-9-5-1-3-7-11(9)16-14(13)10-6-2-4-8-12(10)17-15/h1-8H |
| InChIKey | DFAAGHMEMJPFQG-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 41.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | 734 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6h-Indolo[3,2-c]quinolin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6h-Indolo[3,2-c]quinolin-6-one?
The IUPAC name of 6h-Indolo[3,2-c]quinolin-6-one (CID 88656895) is indolo[3,2-c]quinolin-6-one.
What is the SMILES notation for 6h-Indolo[3,2-c]quinolin-6-one?
The canonical SMILES for 6h-Indolo[3,2-c]quinolin-6-one is C1=CC2=C3C(=C4C=CC=CC4=NC3=O)N=C2C=C1.
What is the InChIKey of 6h-Indolo[3,2-c]quinolin-6-one?
The InChIKey is DFAAGHMEMJPFQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H8N2O/c18-15-13-9-5-1-3-7-11(9)16-14(13)10-6-2-4-8-12(10)17-15/h1-8H.
What are the key properties of 6h-Indolo[3,2-c]quinolin-6-one?
6h-Indolo[3,2-c]quinolin-6-one has a molecular weight of 232.24 g/mol, XLogP of 1.70, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6h-Indolo[3,2-c]quinolin-6-one is sourced from PubChem (CID 88656895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).