C19H21FO2 — CID 88660908
bicyclo[3.1.1]hepta-1(6),2,4-triene;3-[(4-fluorophenyl)methoxy]-2,2-dimethylpropanal (PubChem CID 88660908) has the molecular formula C19H21FO2 and a molecular weight of 300.37 g/mol. Its IUPAC name is bicyclo[3.1.1]hepta-1(6),2,4-triene;3-[(4-fluorophenyl)methoxy]-2,2-dimethylpropanal.
| Compound Name | bicyclo[3.1.1]hepta-1(6),2,4-triene;3-[(4-fluorophenyl)methoxy]-2,2-dimethylpropanal |
|---|---|
| PubChem CID | 88660908 |
| Molecular Formula | C19H21FO2 |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | bicyclo[3.1.1]hepta-1(6),2,4-triene;3-[(4-fluorophenyl)methoxy]-2,2-dimethylpropanal |
| SMILES | CC(C)(C=O)COCc1ccc(F)cc1.c1cc2cc(c1)C2 |
| InChI | InChI=1S/C12H15FO2.C7H6/c1-12(2,8-14)9-15-7-10-3-5-11(13)6-4-10;1-2-6-4-7(3-1)5-6/h3-6,8H,7,9H2,1-2H3;1-4H,5H2 |
| InChIKey | FWLBPNCQEYPEPZ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|