C17H18N4O — CID 88662681
2-[(6aR,9R,10aR)-7-cyano-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]acetamide (PubChem CID 88662681) has the molecular formula C17H18N4O and a molecular weight of 294.36 g/mol. Its IUPAC name is 2-[(6aR,9R,10aR)-7-cyano-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]acetamide.
| Compound Name | 2-[(6aR,9R,10aR)-7-cyano-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]acetamide |
|---|---|
| PubChem CID | 88662681 |
| Molecular Formula | C17H18N4O |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 2-[(6aR,9R,10aR)-7-cyano-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]acetamide |
| SMILES | N#CN1C[C@@H](CC(N)=O)C[C@@H]2c3cccc4[nH]cc(c34)C[C@H]21 |
| InChI | InChI=1S/C17H18N4O/c18-9-21-8-10(5-16(19)22)4-13-12-2-1-3-14-17(12)11(7-20-14)6-15(13)21/h1-3,7,10,13,15,20H,4-6,8H2,(H2,19,22)/t10-,13-,15-/m1/s1 |
| InChIKey | YCMYHZFHWFQYJN-WDBKCZKBSA-N |
| XLogP | 1.85 |
| TPSA | 85.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|