C12H18N2O5S — CID 88663408
1-[2-[(3-oxo-2-sulfanylbutanoyl)amino]propanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 88663408) has the molecular formula C12H18N2O5S and a molecular weight of 302.35 g/mol. Its IUPAC name is 1-[2-[(3-oxo-2-sulfanylbutanoyl)amino]propanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[2-[(3-oxo-2-sulfanylbutanoyl)amino]propanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 88663408 |
| Molecular Formula | C12H18N2O5S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 1-[2-[(3-oxo-2-sulfanylbutanoyl)amino]propanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | CC(=O)C(S)C(=O)NC(C)C(=O)N1CCCC1C(=O)O |
| InChI | InChI=1S/C12H18N2O5S/c1-6(13-10(16)9(20)7(2)15)11(17)14-5-3-4-8(14)12(18)19/h6,8-9,20H,3-5H2,1-2H3,(H,13,16)(H,18,19) |
| InChIKey | KKLBOAITDDZWHU-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|