C11H21N3O3 — CID 70044790
(2S)-1-[2-(2-aminopropan-2-ylamino)propanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 70044790) has the molecular formula C11H21N3O3 and a molecular weight of 243.31 g/mol. Its IUPAC name is (2S)-1-[2-(2-aminopropan-2-ylamino)propanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[2-(2-aminopropan-2-ylamino)propanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 70044790 |
| Molecular Formula | C11H21N3O3 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | (2S)-1-[2-(2-aminopropan-2-ylamino)propanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | CC(NC(C)(C)N)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C11H21N3O3/c1-7(13-11(2,3)12)9(15)14-6-4-5-8(14)10(16)17/h7-8,13H,4-6,12H2,1-3H3,(H,16,17)/t7?,8-/m0/s1 |
| InChIKey | PEYLKGSABQLMGM-MQWKRIRWSA-N |
| XLogP | -0.27 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|