C18H29NO6 — CID 88663617
4-[2-(diethylamino)ethyl]-2-ethyl-5-methylidenehex-2-enedioic acid;prop-2-enoic acid (PubChem CID 88663617) has the molecular formula C18H29NO6 and a molecular weight of 355.43 g/mol. Its IUPAC name is 4-[2-(diethylamino)ethyl]-2-ethyl-5-methylidenehex-2-enedioic acid;prop-2-enoic acid.
| Compound Name | 4-[2-(diethylamino)ethyl]-2-ethyl-5-methylidenehex-2-enedioic acid;prop-2-enoic acid |
|---|---|
| PubChem CID | 88663617 |
| Molecular Formula | C18H29NO6 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | 4-[2-(diethylamino)ethyl]-2-ethyl-5-methylidenehex-2-enedioic acid;prop-2-enoic acid |
| SMILES | C=C(C(=O)O)C(C=C(CC)C(=O)O)CCN(CC)CC.C=CC(=O)O |
| InChI | InChI=1S/C15H25NO4.C3H4O2/c1-5-12(15(19)20)10-13(11(4)14(17)18)8-9-16(6-2)7-3;1-2-3(4)5/h10,13H,4-9H2,1-3H3,(H,17,18)(H,19,20);2H,1H2,(H,4,5) |
| InChIKey | OPFYRRVJUSKKQU-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|