C18H32N2O4 — CID 87347839
4-[2-(diethylamino)ethoxycarbonyl]-2-[2-(diethylamino)ethyl]penta-2,4-dienoic acid (PubChem CID 87347839) has the molecular formula C18H32N2O4 and a molecular weight of 340.46 g/mol. Its IUPAC name is 4-[2-(diethylamino)ethoxycarbonyl]-2-[2-(diethylamino)ethyl]penta-2,4-dienoic acid.
| Compound Name | 4-[2-(diethylamino)ethoxycarbonyl]-2-[2-(diethylamino)ethyl]penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 87347839 |
| Molecular Formula | C18H32N2O4 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | 4-[2-(diethylamino)ethoxycarbonyl]-2-[2-(diethylamino)ethyl]penta-2,4-dienoic acid |
| SMILES | C=C(C=C(CCN(CC)CC)C(=O)O)C(=O)OCCN(CC)CC |
| InChI | InChI=1S/C18H32N2O4/c1-6-19(7-2)11-10-16(17(21)22)14-15(5)18(23)24-13-12-20(8-3)9-4/h14H,5-13H2,1-4H3,(H,21,22) |
| InChIKey | PWNGQOLQDFNWKF-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|