C17H17N3O5S — CID 88665892
methyl 5,7-dimethyl-2-(2-methylphenoxy)sulfonylpyrazolo[1,5-a]pyrimidine-3-carboxylate (PubChem CID 88665892) has the molecular formula C17H17N3O5S and a molecular weight of 375.41 g/mol. Its IUPAC name is methyl 5,7-dimethyl-2-(2-methylphenoxy)sulfonylpyrazolo[1,5-a]pyrimidine-3-carboxylate.
| Compound Name | methyl 5,7-dimethyl-2-(2-methylphenoxy)sulfonylpyrazolo[1,5-a]pyrimidine-3-carboxylate |
|---|---|
| PubChem CID | 88665892 |
| Molecular Formula | C17H17N3O5S |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | methyl 5,7-dimethyl-2-(2-methylphenoxy)sulfonylpyrazolo[1,5-a]pyrimidine-3-carboxylate |
| SMILES | COC(=O)c1c(S(=O)(=O)Oc2ccccc2C)nn2c(C)cc(C)nc12 |
| InChI | InChI=1S/C17H17N3O5S/c1-10-7-5-6-8-13(10)25-26(22,23)16-14(17(21)24-4)15-18-11(2)9-12(3)20(15)19-16/h5-9H,1-4H3 |
| InChIKey | HEGDJFXTAMJLJU-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 99.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|