C40H74O6 — CID 88668414
[4,4-dihydroxy-3-[(Z)-octadec-9-enoyl]oxybutan-2-yl] (Z)-octadec-9-enoate (PubChem CID 88668414) has the molecular formula C40H74O6 and a molecular weight of 651.03 g/mol. Its IUPAC name is [4,4-dihydroxy-3-[(Z)-octadec-9-enoyl]oxybutan-2-yl] (Z)-octadec-9-enoate.
| Compound Name | [4,4-dihydroxy-3-[(Z)-octadec-9-enoyl]oxybutan-2-yl] (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 88668414 |
| Molecular Formula | C40H74O6 |
| Molecular Weight | 651.03 g/mol |
| Exact Mass | 650.55 |
| IUPAC Name | [4,4-dihydroxy-3-[(Z)-octadec-9-enoyl]oxybutan-2-yl] (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC(C)C(OC(=O)CCCCCCC/C=C\CCCCCCCC)C(O)O |
| InChI | InChI=1S/C40H74O6/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-37(41)45-36(3)39(40(43)44)46-38(42)35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h18-21,36,39-40,43-44H,4-17,22-35H2,1-3H3/b20-18-,21-19- |
| InChIKey | BYHOMXADBDZUHS-AUYXYSRISA-N |
| XLogP | 11.22 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.03 |
| LogP ≤ 5 | 11.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|