C29H59N2O6P — CID 88669128
[1-[(Z)-octadec-9-enoxy]-3-(2-oxopropylamino)propan-2-yl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 88669128) has the molecular formula C29H59N2O6P and a molecular weight of 562.77 g/mol. Its IUPAC name is [1-[(Z)-octadec-9-enoxy]-3-(2-oxopropylamino)propan-2-yl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [1-[(Z)-octadec-9-enoxy]-3-(2-oxopropylamino)propan-2-yl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 88669128 |
| Molecular Formula | C29H59N2O6P |
| Molecular Weight | 562.77 g/mol |
| Exact Mass | 562.41 |
| IUPAC Name | [1-[(Z)-octadec-9-enoxy]-3-(2-oxopropylamino)propan-2-yl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOCC(CNCC(C)=O)OP(=O)([O-])OCC[N+](C)(C)C |
| InChI | InChI=1S/C29H59N2O6P/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-23-35-27-29(26-30-25-28(2)32)37-38(33,34)36-24-22-31(3,4)5/h13-14,29-30H,6-12,15-27H2,1-5H3/b14-13- |
| InChIKey | GIVKHABWELVTFY-YPKPFQOOSA-N |
| XLogP | 5.80 |
| TPSA | 96.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.77 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|