C18H20Cl2NO5P — CID 88671909
2-[2-bis(4-chloro-3-methylphenoxy)phosphorylethylamino]acetic acid (PubChem CID 88671909) has the molecular formula C18H20Cl2NO5P and a molecular weight of 432.24 g/mol. Its IUPAC name is 2-[2-bis(4-chloro-3-methylphenoxy)phosphorylethylamino]acetic acid.
| Compound Name | 2-[2-bis(4-chloro-3-methylphenoxy)phosphorylethylamino]acetic acid |
|---|---|
| PubChem CID | 88671909 |
| Molecular Formula | C18H20Cl2NO5P |
| Molecular Weight | 432.24 g/mol |
| Exact Mass | 431.05 |
| IUPAC Name | 2-[2-bis(4-chloro-3-methylphenoxy)phosphorylethylamino]acetic acid |
| SMILES | Cc1cc(OP(=O)(CCNCC(=O)O)Oc2ccc(Cl)c(C)c2)ccc1Cl |
| InChI | InChI=1S/C18H20Cl2NO5P/c1-12-9-14(3-5-16(12)19)25-27(24,8-7-21-11-18(22)23)26-15-4-6-17(20)13(2)10-15/h3-6,9-10,21H,7-8,11H2,1-2H3,(H,22,23) |
| InChIKey | IWANLIBUDZWCFY-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.24 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|