C20H14Cl4NO4PS2 — CID 88676625
bis(2,4-dichlorophenoxy)-(2-nitro-1-phenylethyl)sulfanyl-sulfanylidene-λ5-phosphane (PubChem CID 88676625) has the molecular formula C20H14Cl4NO4PS2 and a molecular weight of 569.26 g/mol. Its IUPAC name is bis(2,4-dichlorophenoxy)-(2-nitro-1-phenylethyl)sulfanyl-sulfanylidene-λ5-phosphane.
| Compound Name | bis(2,4-dichlorophenoxy)-(2-nitro-1-phenylethyl)sulfanyl-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 88676625 |
| Molecular Formula | C20H14Cl4NO4PS2 |
| Molecular Weight | 569.26 g/mol |
| Exact Mass | 566.89 |
| IUPAC Name | bis(2,4-dichlorophenoxy)-(2-nitro-1-phenylethyl)sulfanyl-sulfanylidene-λ5-phosphane |
| SMILES | O=[N+]([O-])CC(SP(=S)(Oc1ccc(Cl)cc1Cl)Oc1ccc(Cl)cc1Cl)c1ccccc1 |
| InChI | InChI=1S/C20H14Cl4NO4PS2/c21-14-6-8-18(16(23)10-14)28-30(31,29-19-9-7-15(22)11-17(19)24)32-20(12-25(26)27)13-4-2-1-3-5-13/h1-11,20H,12H2 |
| InChIKey | ACYAZDQPUMLBDJ-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.26 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|