About calcium;heptan-1-ol;oxido-oxo-phosphooxyphosphanium
calcium;heptan-1-ol;oxido-oxo-phosphooxyphosphanium (PubChem CID 88678862) has the molecular formula C7H16CaO6P2+2
and a molecular weight of 298.23 g/mol. Its IUPAC name is calcium;heptan-1-ol;oxido-oxo-phosphooxyphosphanium.
Molecular Properties
| Compound Name | calcium;heptan-1-ol;oxido-oxo-phosphooxyphosphanium |
| PubChem CID | 88678862 |
| Molecular Formula | C7H16CaO6P2+2 |
| Molecular Weight | 298.23 g/mol |
| Exact Mass | 298.00 |
| IUPAC Name | calcium;heptan-1-ol;oxido-oxo-phosphooxyphosphanium |
| SMILES | CCCCCCCO.O=[P+]([O-])O[P+](=O)[O-].[Ca+2] |
| InChI | InChI=1S/C7H16O.Ca.O5P2/c1-2-3-4-5-6-7-8;;1-6(2)5-7(3)4/h8H,2-7H2,1H3;;/q;+2; |
| InChIKey | CTGZNRFEAALBNP-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 109.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.23 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze calcium;heptan-1-ol;oxido-oxo-phosphooxyphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;heptan-1-ol;oxido-oxo-phosphooxyphosphanium?
The IUPAC name of calcium;heptan-1-ol;oxido-oxo-phosphooxyphosphanium (CID 88678862) is calcium;heptan-1-ol;oxido-oxo-phosphooxyphosphanium.
What is the SMILES notation for calcium;heptan-1-ol;oxido-oxo-phosphooxyphosphanium?
The canonical SMILES for calcium;heptan-1-ol;oxido-oxo-phosphooxyphosphanium is CCCCCCCO.O=[P+]([O-])O[P+](=O)[O-].[Ca+2].
What is the InChIKey of calcium;heptan-1-ol;oxido-oxo-phosphooxyphosphanium?
The InChIKey is CTGZNRFEAALBNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16O.Ca.O5P2/c1-2-3-4-5-6-7-8;;1-6(2)5-7(3)4/h8H,2-7H2,1H3;;/q;+2;.
What are the key properties of calcium;heptan-1-ol;oxido-oxo-phosphooxyphosphanium?
calcium;heptan-1-ol;oxido-oxo-phosphooxyphosphanium has a molecular weight of 298.23 g/mol, XLogP of 0.61, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;heptan-1-ol;oxido-oxo-phosphooxyphosphanium is sourced from PubChem (CID 88678862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).