C21H23ClN2O4 — CID 8867891
[4-(4-acetylpiperazin-1-yl)phenyl] 2-(4-chloro-2-methylphenoxy)acetate (PubChem CID 8867891) has the molecular formula C21H23ClN2O4 and a molecular weight of 402.88 g/mol. Its IUPAC name is [4-(4-acetylpiperazin-1-yl)phenyl] 2-(4-chloro-2-methylphenoxy)acetate.
| Compound Name | [4-(4-acetylpiperazin-1-yl)phenyl] 2-(4-chloro-2-methylphenoxy)acetate |
|---|---|
| PubChem CID | 8867891 |
| Molecular Formula | C21H23ClN2O4 |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | [4-(4-acetylpiperazin-1-yl)phenyl] 2-(4-chloro-2-methylphenoxy)acetate |
| SMILES | CC(=O)N1CCN(c2ccc(OC(=O)COc3ccc(Cl)cc3C)cc2)CC1 |
| InChI | InChI=1S/C21H23ClN2O4/c1-15-13-17(22)3-8-20(15)27-14-21(26)28-19-6-4-18(5-7-19)24-11-9-23(10-12-24)16(2)25/h3-8,13H,9-12,14H2,1-2H3 |
| InChIKey | FGBZJMQWOBUNOH-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|