About calcium;oxido-oxo-phosphooxyphosphanium;phenylmethanol
calcium;oxido-oxo-phosphooxyphosphanium;phenylmethanol (PubChem CID 88679771) has the molecular formula C7H8CaO6P2+2
and a molecular weight of 290.16 g/mol. Its IUPAC name is calcium;oxido-oxo-phosphooxyphosphanium;phenylmethanol.
Molecular Properties
| Compound Name | calcium;oxido-oxo-phosphooxyphosphanium;phenylmethanol |
| PubChem CID | 88679771 |
| Molecular Formula | C7H8CaO6P2+2 |
| Molecular Weight | 290.16 g/mol |
| Exact Mass | 289.94 |
| IUPAC Name | calcium;oxido-oxo-phosphooxyphosphanium;phenylmethanol |
| SMILES | O=[P+]([O-])O[P+](=O)[O-].OCc1ccccc1.[Ca+2] |
| InChI | InChI=1S/C7H8O.Ca.O5P2/c8-6-7-4-2-1-3-5-7;;1-6(2)5-7(3)4/h1-5,8H,6H2;;/q;+2; |
| InChIKey | IYBVCUQXGVEYSJ-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 109.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.16 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze calcium;oxido-oxo-phosphooxyphosphanium;phenylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;oxido-oxo-phosphooxyphosphanium;phenylmethanol?
The IUPAC name of calcium;oxido-oxo-phosphooxyphosphanium;phenylmethanol (CID 88679771) is calcium;oxido-oxo-phosphooxyphosphanium;phenylmethanol.
What is the SMILES notation for calcium;oxido-oxo-phosphooxyphosphanium;phenylmethanol?
The canonical SMILES for calcium;oxido-oxo-phosphooxyphosphanium;phenylmethanol is O=[P+]([O-])O[P+](=O)[O-].OCc1ccccc1.[Ca+2].
What is the InChIKey of calcium;oxido-oxo-phosphooxyphosphanium;phenylmethanol?
The InChIKey is IYBVCUQXGVEYSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O.Ca.O5P2/c8-6-7-4-2-1-3-5-7;;1-6(2)5-7(3)4/h1-5,8H,6H2;;/q;+2;.
What are the key properties of calcium;oxido-oxo-phosphooxyphosphanium;phenylmethanol?
calcium;oxido-oxo-phosphooxyphosphanium;phenylmethanol has a molecular weight of 290.16 g/mol, XLogP of -0.16, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;oxido-oxo-phosphooxyphosphanium;phenylmethanol is sourced from PubChem (CID 88679771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).