About calcium;oxido-oxo-phosphooxyphosphanium;prop-2-enylbenzene
calcium;oxido-oxo-phosphooxyphosphanium;prop-2-enylbenzene (PubChem CID 88679774) has the molecular formula C9H10CaO5P2+2
and a molecular weight of 300.20 g/mol. Its IUPAC name is calcium;oxido-oxo-phosphooxyphosphanium;prop-2-enylbenzene.
Molecular Properties
| Compound Name | calcium;oxido-oxo-phosphooxyphosphanium;prop-2-enylbenzene |
| PubChem CID | 88679774 |
| Molecular Formula | C9H10CaO5P2+2 |
| Molecular Weight | 300.20 g/mol |
| Exact Mass | 299.96 |
| IUPAC Name | calcium;oxido-oxo-phosphooxyphosphanium;prop-2-enylbenzene |
| SMILES | C=CCc1ccccc1.O=[P+]([O-])O[P+](=O)[O-].[Ca+2] |
| InChI | InChI=1S/C9H10.Ca.O5P2/c1-2-6-9-7-4-3-5-8-9;;1-6(2)5-7(3)4/h2-5,7-8H,1,6H2;;/q;+2; |
| InChIKey | GRNUJNQQOOORLR-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 89.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.20 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze calcium;oxido-oxo-phosphooxyphosphanium;prop-2-enylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;oxido-oxo-phosphooxyphosphanium;prop-2-enylbenzene?
The IUPAC name of calcium;oxido-oxo-phosphooxyphosphanium;prop-2-enylbenzene (CID 88679774) is calcium;oxido-oxo-phosphooxyphosphanium;prop-2-enylbenzene.
What is the SMILES notation for calcium;oxido-oxo-phosphooxyphosphanium;prop-2-enylbenzene?
The canonical SMILES for calcium;oxido-oxo-phosphooxyphosphanium;prop-2-enylbenzene is C=CCc1ccccc1.O=[P+]([O-])O[P+](=O)[O-].[Ca+2].
What is the InChIKey of calcium;oxido-oxo-phosphooxyphosphanium;prop-2-enylbenzene?
The InChIKey is GRNUJNQQOOORLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10.Ca.O5P2/c1-2-6-9-7-4-3-5-8-9;;1-6(2)5-7(3)4/h2-5,7-8H,1,6H2;;/q;+2;.
What are the key properties of calcium;oxido-oxo-phosphooxyphosphanium;prop-2-enylbenzene?
calcium;oxido-oxo-phosphooxyphosphanium;prop-2-enylbenzene has a molecular weight of 300.20 g/mol, XLogP of 1.07, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;oxido-oxo-phosphooxyphosphanium;prop-2-enylbenzene is sourced from PubChem (CID 88679774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).