C29H26N2O7S2 — CID 88683829
benzhydryl (6R)-3-(acetyloxymethyl)-7-[hydroxy-(2-thiophen-2-ylacetyl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 88683829) has the molecular formula C29H26N2O7S2 and a molecular weight of 578.67 g/mol. Its IUPAC name is benzhydryl (6R)-3-(acetyloxymethyl)-7-[hydroxy-(2-thiophen-2-ylacetyl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | benzhydryl (6R)-3-(acetyloxymethyl)-7-[hydroxy-(2-thiophen-2-ylacetyl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 88683829 |
| Molecular Formula | C29H26N2O7S2 |
| Molecular Weight | 578.67 g/mol |
| Exact Mass | 578.12 |
| IUPAC Name | benzhydryl (6R)-3-(acetyloxymethyl)-7-[hydroxy-(2-thiophen-2-ylacetyl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CC(=O)OCC1=C(C(=O)OC(c2ccccc2)c2ccccc2)N2C(=O)C(N(O)C(=O)Cc3cccs3)[C@H]2SC1 |
| InChI | InChI=1S/C29H26N2O7S2/c1-18(32)37-16-21-17-40-28-25(31(36)23(33)15-22-13-8-14-39-22)27(34)30(28)24(21)29(35)38-26(19-9-4-2-5-10-19)20-11-6-3-7-12-20/h2-14,25-26,28,36H,15-17H2,1H3/t25?,28-/m1/s1 |
| InChIKey | KCPPMZRJCKGWQE-MPSNESSQSA-N |
| XLogP | 3.94 |
| TPSA | 113.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.67 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|