C28H31N3O7S — CID 70464515
benzhydryl (6R,7R)-3-(acetyloxymethyl)-7-[amino-[(2-methylpropan-2-yl)oxycarbonyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 70464515) has the molecular formula C28H31N3O7S and a molecular weight of 553.64 g/mol. Its IUPAC name is benzhydryl (6R,7R)-3-(acetyloxymethyl)-7-[amino-[(2-methylpropan-2-yl)oxycarbonyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | benzhydryl (6R,7R)-3-(acetyloxymethyl)-7-[amino-[(2-methylpropan-2-yl)oxycarbonyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 70464515 |
| Molecular Formula | C28H31N3O7S |
| Molecular Weight | 553.64 g/mol |
| Exact Mass | 553.19 |
| IUPAC Name | benzhydryl (6R,7R)-3-(acetyloxymethyl)-7-[amino-[(2-methylpropan-2-yl)oxycarbonyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CC(=O)OCC1=C(C(=O)OC(c2ccccc2)c2ccccc2)N2C(=O)[C@@H](N(N)C(=O)OC(C)(C)C)[C@H]2SC1 |
| InChI | InChI=1S/C28H31N3O7S/c1-17(32)36-15-20-16-39-25-22(31(29)27(35)38-28(2,3)4)24(33)30(25)21(20)26(34)37-23(18-11-7-5-8-12-18)19-13-9-6-10-14-19/h5-14,22-23,25H,15-16,29H2,1-4H3/t22-,25-/m1/s1 |
| InChIKey | LEKCMENGTKMYSA-RCZVLFRGSA-N |
| XLogP | 3.53 |
| TPSA | 128.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.64 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|