C11H15FO3S — CID 88683863
1-(3-tert-butylsulfanyl-2-fluoro-3-oxoprop-1-enyl)cyclopropane-1-carboxylic acid (PubChem CID 88683863) has the molecular formula C11H15FO3S and a molecular weight of 246.30 g/mol. Its IUPAC name is 1-(3-tert-butylsulfanyl-2-fluoro-3-oxoprop-1-enyl)cyclopropane-1-carboxylic acid.
| Compound Name | 1-(3-tert-butylsulfanyl-2-fluoro-3-oxoprop-1-enyl)cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 88683863 |
| Molecular Formula | C11H15FO3S |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 1-(3-tert-butylsulfanyl-2-fluoro-3-oxoprop-1-enyl)cyclopropane-1-carboxylic acid |
| SMILES | CC(C)(C)SC(=O)C(F)=CC1(C(=O)O)CC1 |
| InChI | InChI=1S/C11H15FO3S/c1-10(2,3)16-8(13)7(12)6-11(4-5-11)9(14)15/h6H,4-5H2,1-3H3,(H,14,15) |
| InChIKey | QNTBCPWOSONZFH-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|