C20H17NO5 — CID 88686426
(2Z)-2-[[3-[formyl(propan-2-yl)amino]phenyl]methylidene]-3-oxo-1-benzofuran-5-carboxylic acid (PubChem CID 88686426) has the molecular formula C20H17NO5 and a molecular weight of 351.36 g/mol. Its IUPAC name is (2Z)-2-[[3-[formyl(propan-2-yl)amino]phenyl]methylidene]-3-oxo-1-benzofuran-5-carboxylic acid.
| Compound Name | (2Z)-2-[[3-[formyl(propan-2-yl)amino]phenyl]methylidene]-3-oxo-1-benzofuran-5-carboxylic acid |
|---|---|
| PubChem CID | 88686426 |
| Molecular Formula | C20H17NO5 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | (2Z)-2-[[3-[formyl(propan-2-yl)amino]phenyl]methylidene]-3-oxo-1-benzofuran-5-carboxylic acid |
| SMILES | CC(C)N(C=O)c1cccc(/C=C2\Oc3ccc(C(=O)O)cc3C2=O)c1 |
| InChI | InChI=1S/C20H17NO5/c1-12(2)21(11-22)15-5-3-4-13(8-15)9-18-19(23)16-10-14(20(24)25)6-7-17(16)26-18/h3-12H,1-2H3,(H,24,25)/b18-9- |
| InChIKey | WKHUTNIUJAJHFN-NVMNQCDNSA-N |
| XLogP | 3.37 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|