C33H50O7 — CID 88686635
[(1R,3Z,5R)-3-[2-[(1R,7aR)-1-[(2R,5S)-5-acetyloxy-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-5-acetyloxy-4-methylidenecyclohexyl] acetate (PubChem CID 88686635) has the molecular formula C33H50O7 and a molecular weight of 558.76 g/mol. Its IUPAC name is [(1R,3Z,5R)-3-[2-[(1R,7aR)-1-[(2R,5S)-5-acetyloxy-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-5-acetyloxy-4-methylidenecyclohexyl] acetate.
| Compound Name | [(1R,3Z,5R)-3-[2-[(1R,7aR)-1-[(2R,5S)-5-acetyloxy-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-5-acetyloxy-4-methylidenecyclohexyl] acetate |
|---|---|
| PubChem CID | 88686635 |
| Molecular Formula | C33H50O7 |
| Molecular Weight | 558.76 g/mol |
| Exact Mass | 558.36 |
| IUPAC Name | [(1R,3Z,5R)-3-[2-[(1R,7aR)-1-[(2R,5S)-5-acetyloxy-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-5-acetyloxy-4-methylidenecyclohexyl] acetate |
| SMILES | C=C1/C(=C\C=C2CCC[C@@]3(C)C2CC[C@@H]3[C@H](C)CC[C@H](OC(C)=O)C(C)(C)O)C[C@@H](OC(C)=O)C[C@H]1OC(C)=O |
| InChI | InChI=1S/C33H50O7/c1-20(11-16-31(32(6,7)37)40-24(5)36)28-14-15-29-25(10-9-17-33(28,29)8)12-13-26-18-27(38-22(3)34)19-30(21(26)2)39-23(4)35/h12-13,20,27-31,37H,2,9-11,14-19H2,1,3-8H3/b25-12?,26-13-/t20-,27-,28-,29?,30-,31+,33-/m1/s1 |
| InChIKey | XSZRHIWETATCQE-JQPBKLNVSA-N |
| XLogP | 6.39 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.76 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|