C33H50O6 — CID 88818657
[(1R,3Z,5R)-3-[2-[(1R,7aR)-1-[(2R)-5-acetyloxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-5-acetyloxy-4-methylidenecyclohexyl] acetate (PubChem CID 88818657) has the molecular formula C33H50O6 and a molecular weight of 542.76 g/mol. Its IUPAC name is [(1R,3Z,5R)-3-[2-[(1R,7aR)-1-[(2R)-5-acetyloxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-5-acetyloxy-4-methylidenecyclohexyl] acetate.
| Compound Name | [(1R,3Z,5R)-3-[2-[(1R,7aR)-1-[(2R)-5-acetyloxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-5-acetyloxy-4-methylidenecyclohexyl] acetate |
|---|---|
| PubChem CID | 88818657 |
| Molecular Formula | C33H50O6 |
| Molecular Weight | 542.76 g/mol |
| Exact Mass | 542.36 |
| IUPAC Name | [(1R,3Z,5R)-3-[2-[(1R,7aR)-1-[(2R)-5-acetyloxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-5-acetyloxy-4-methylidenecyclohexyl] acetate |
| SMILES | C=C1/C(=C\C=C2CCC[C@@]3(C)C2CC[C@@H]3[C@H](C)CCC(OC(C)=O)C(C)C)C[C@@H](OC(C)=O)C[C@H]1OC(C)=O |
| InChI | InChI=1S/C33H50O6/c1-20(2)31(38-24(6)35)16-11-21(3)29-14-15-30-26(10-9-17-33(29,30)8)12-13-27-18-28(37-23(5)34)19-32(22(27)4)39-25(7)36/h12-13,20-21,28-32H,4,9-11,14-19H2,1-3,5-8H3/b26-12?,27-13-/t21-,28-,29-,30?,31?,32-,33-/m1/s1 |
| InChIKey | OSKHNMIHRDLLJL-BCUIWFRSSA-N |
| XLogP | 7.27 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.76 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|