C8H22N4O — CID 88686744
5-(2,3-diaminopropoxy)pentane-1,2-diamine (PubChem CID 88686744) has the molecular formula C8H22N4O and a molecular weight of 190.29 g/mol. Its IUPAC name is 5-(2,3-diaminopropoxy)pentane-1,2-diamine.
| Compound Name | 5-(2,3-diaminopropoxy)pentane-1,2-diamine |
|---|---|
| PubChem CID | 88686744 |
| Molecular Formula | C8H22N4O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.18 |
| IUPAC Name | 5-(2,3-diaminopropoxy)pentane-1,2-diamine |
| SMILES | NCC(N)CCCOCC(N)CN |
| InChI | InChI=1S/C8H22N4O/c9-4-7(11)2-1-3-13-6-8(12)5-10/h7-8H,1-6,9-12H2 |
| InChIKey | LIQRZEMMVKGDST-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 113.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|