C16H18O8S — CID 88688649
1-[4-[4-(1,1-dihydroxyethoxy)phenyl]sulfonylphenoxy]ethane-1,1-diol (PubChem CID 88688649) has the molecular formula C16H18O8S and a molecular weight of 370.38 g/mol. Its IUPAC name is 1-[4-[4-(1,1-dihydroxyethoxy)phenyl]sulfonylphenoxy]ethane-1,1-diol.
| Compound Name | 1-[4-[4-(1,1-dihydroxyethoxy)phenyl]sulfonylphenoxy]ethane-1,1-diol |
|---|---|
| PubChem CID | 88688649 |
| Molecular Formula | C16H18O8S |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | 1-[4-[4-(1,1-dihydroxyethoxy)phenyl]sulfonylphenoxy]ethane-1,1-diol |
| SMILES | CC(O)(O)Oc1ccc(S(=O)(=O)c2ccc(OC(C)(O)O)cc2)cc1 |
| InChI | InChI=1S/C16H18O8S/c1-15(17,18)23-11-3-7-13(8-4-11)25(21,22)14-9-5-12(6-10-14)24-16(2,19)20/h3-10,17-20H,1-2H3 |
| InChIKey | ALKJYOXMYLDIGJ-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|