About cyanic acid;tributyl(methyl)azanium
cyanic acid;tributyl(methyl)azanium (PubChem CID 88689945) has the molecular formula C14H31N2O+
and a molecular weight of 243.41 g/mol. Its IUPAC name is cyanic acid;tributyl(methyl)azanium.
Molecular Properties
| Compound Name | cyanic acid;tributyl(methyl)azanium |
| PubChem CID | 88689945 |
| Molecular Formula | C14H31N2O+ |
| Molecular Weight | 243.41 g/mol |
| Exact Mass | 243.24 |
| IUPAC Name | cyanic acid;tributyl(methyl)azanium |
| SMILES | CCCC[N+](C)(CCCC)CCCC.N#CO |
| InChI | InChI=1S/C13H30N.CHNO/c1-5-8-11-14(4,12-9-6-2)13-10-7-3;2-1-3/h5-13H2,1-4H3;3H/q+1; |
| InChIKey | FIHOGFOEZFZJEL-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.41 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze cyanic acid;tributyl(methyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyanic acid;tributyl(methyl)azanium?
The IUPAC name of cyanic acid;tributyl(methyl)azanium (CID 88689945) is cyanic acid;tributyl(methyl)azanium.
What is the SMILES notation for cyanic acid;tributyl(methyl)azanium?
The canonical SMILES for cyanic acid;tributyl(methyl)azanium is CCCC[N+](C)(CCCC)CCCC.N#CO.
What is the InChIKey of cyanic acid;tributyl(methyl)azanium?
The InChIKey is FIHOGFOEZFZJEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H30N.CHNO/c1-5-8-11-14(4,12-9-6-2)13-10-7-3;2-1-3/h5-13H2,1-4H3;3H/q+1;.
What are the key properties of cyanic acid;tributyl(methyl)azanium?
cyanic acid;tributyl(methyl)azanium has a molecular weight of 243.41 g/mol, XLogP of 3.67, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyanic acid;tributyl(methyl)azanium is sourced from PubChem (CID 88689945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).