About cyanic acid;tetrapentylazanium
cyanic acid;tetrapentylazanium (PubChem CID 88689750) has the molecular formula C21H45N2O+
and a molecular weight of 341.60 g/mol. Its IUPAC name is cyanic acid;tetrapentylazanium.
Molecular Properties
| Compound Name | cyanic acid;tetrapentylazanium |
| PubChem CID | 88689750 |
| Molecular Formula | C21H45N2O+ |
| Molecular Weight | 341.60 g/mol |
| Exact Mass | 341.35 |
| IUPAC Name | cyanic acid;tetrapentylazanium |
| SMILES | CCCCC[N+](CCCCC)(CCCCC)CCCCC.N#CO |
| InChI | InChI=1S/C20H44N.CHNO/c1-5-9-13-17-21(18-14-10-6-2,19-15-11-7-3)20-16-12-8-4;2-1-3/h5-20H2,1-4H3;3H/q+1; |
| InChIKey | ZKZBGSDRPHLIBM-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 341.60 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze cyanic acid;tetrapentylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyanic acid;tetrapentylazanium?
The IUPAC name of cyanic acid;tetrapentylazanium (CID 88689750) is cyanic acid;tetrapentylazanium.
What is the SMILES notation for cyanic acid;tetrapentylazanium?
The canonical SMILES for cyanic acid;tetrapentylazanium is CCCCC[N+](CCCCC)(CCCCC)CCCCC.N#CO.
What is the InChIKey of cyanic acid;tetrapentylazanium?
The InChIKey is ZKZBGSDRPHLIBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H44N.CHNO/c1-5-9-13-17-21(18-14-10-6-2,19-15-11-7-3)20-16-12-8-4;2-1-3/h5-20H2,1-4H3;3H/q+1;.
What are the key properties of cyanic acid;tetrapentylazanium?
cyanic acid;tetrapentylazanium has a molecular weight of 341.60 g/mol, XLogP of 6.40, 16 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyanic acid;tetrapentylazanium is sourced from PubChem (CID 88689750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).